C14H15F6N — CID 63052233
2-(trifluoromethyl)-N-[(3,4,5-trifluorophenyl)methyl]cyclohexan-1-amine (PubChem CID 63052233) has the molecular formula C14H15F6N and a molecular weight of 311.27 g/mol. Its IUPAC name is 2-(trifluoromethyl)-N-[(3,4,5-trifluorophenyl)methyl]cyclohexan-1-amine.
| Compound Name | 2-(trifluoromethyl)-N-[(3,4,5-trifluorophenyl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 63052233 |
| Molecular Formula | C14H15F6N |
| Molecular Weight | 311.27 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 2-(trifluoromethyl)-N-[(3,4,5-trifluorophenyl)methyl]cyclohexan-1-amine |
| SMILES | Fc1cc(CNC2CCCCC2C(F)(F)F)cc(F)c1F |
| InChI | InChI=1S/C14H15F6N/c15-10-5-8(6-11(16)13(10)17)7-21-12-4-2-1-3-9(12)14(18,19)20/h5-6,9,12,21H,1-4,7H2 |
| InChIKey | QEQXJRWIOFMGEY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.27 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|