C13H30N4O — CID 63053033
4-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2-(methylamino)butanamide (PubChem CID 63053033) has the molecular formula C13H30N4O and a molecular weight of 258.41 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2-(methylamino)butanamide.
| Compound Name | 4-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2-(methylamino)butanamide |
|---|---|
| PubChem CID | 63053033 |
| Molecular Formula | C13H30N4O |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.24 |
| IUPAC Name | 4-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]-2-(methylamino)butanamide |
| SMILES | CNC(CCN(CCN(C)C)CC(C)C)C(N)=O |
| InChI | InChI=1S/C13H30N4O/c1-11(2)10-17(9-8-16(4)5)7-6-12(15-3)13(14)18/h11-12,15H,6-10H2,1-5H3,(H2,14,18) |
| InChIKey | DKFHGWJTNAAOCW-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |