C11H23N3O3S — CID 63055271
4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(propan-2-ylamino)butanamide (PubChem CID 63055271) has the molecular formula C11H23N3O3S and a molecular weight of 277.39 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(propan-2-ylamino)butanamide.
| Compound Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(propan-2-ylamino)butanamide |
|---|---|
| PubChem CID | 63055271 |
| Molecular Formula | C11H23N3O3S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(propan-2-ylamino)butanamide |
| SMILES | CC(C)NC(CCN1CCS(=O)(=O)CC1)C(N)=O |
| InChI | InChI=1S/C11H23N3O3S/c1-9(2)13-10(11(12)15)3-4-14-5-7-18(16,17)8-6-14/h9-10,13H,3-8H2,1-2H3,(H2,12,15) |
| InChIKey | IMBFDTJFEDAROB-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |