About 4-(4,4-dimethylazepan-1-yl)-2-(propan-2-ylamino)butanamide
4-(4,4-dimethylazepan-1-yl)-2-(propan-2-ylamino)butanamide (PubChem CID 65281802) has the molecular formula C15H31N3O
and a molecular weight of 269.43 g/mol. Its IUPAC name is 4-(4,4-dimethylazepan-1-yl)-2-(propan-2-ylamino)butanamide.
Molecular Properties
| Compound Name | 4-(4,4-dimethylazepan-1-yl)-2-(propan-2-ylamino)butanamide |
| PubChem CID | 65281802 |
| Molecular Formula | C15H31N3O |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.25 |
| IUPAC Name | 4-(4,4-dimethylazepan-1-yl)-2-(propan-2-ylamino)butanamide |
| SMILES | CC(C)NC(CCN1CCCC(C)(C)CC1)C(N)=O |
| InChI | InChI=1S/C15H31N3O/c1-12(2)17-13(14(16)19)6-10-18-9-5-7-15(3,4)8-11-18/h12-13,17H,5-11H2,1-4H3,(H2,16,19) |
| InChIKey | NTOGHZZHBIPAQF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4,4-dimethylazepan-1-yl)-2-(propan-2-ylamino)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,4-dimethylazepan-1-yl)-2-(propan-2-ylamino)butanamide?
The IUPAC name of 4-(4,4-dimethylazepan-1-yl)-2-(propan-2-ylamino)butanamide (CID 65281802) is 4-(4,4-dimethylazepan-1-yl)-2-(propan-2-ylamino)butanamide.
What is the SMILES notation for 4-(4,4-dimethylazepan-1-yl)-2-(propan-2-ylamino)butanamide?
The canonical SMILES for 4-(4,4-dimethylazepan-1-yl)-2-(propan-2-ylamino)butanamide is CC(C)NC(CCN1CCCC(C)(C)CC1)C(N)=O.
What is the InChIKey of 4-(4,4-dimethylazepan-1-yl)-2-(propan-2-ylamino)butanamide?
The InChIKey is NTOGHZZHBIPAQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N3O/c1-12(2)17-13(14(16)19)6-10-18-9-5-7-15(3,4)8-11-18/h12-13,17H,5-11H2,1-4H3,(H2,16,19).
What are the key properties of 4-(4,4-dimethylazepan-1-yl)-2-(propan-2-ylamino)butanamide?
4-(4,4-dimethylazepan-1-yl)-2-(propan-2-ylamino)butanamide has a molecular weight of 269.43 g/mol, XLogP of 1.74, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,4-dimethylazepan-1-yl)-2-(propan-2-ylamino)butanamide is sourced from PubChem (CID 65281802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).