C14H22BrNO3S — CID 63056495
N-[[5-bromo-2-(2-methylsulfonylethoxy)phenyl]methyl]-2-methylpropan-1-amine (PubChem CID 63056495) has the molecular formula C14H22BrNO3S and a molecular weight of 364.31 g/mol. Its IUPAC name is N-[[5-bromo-2-(2-methylsulfonylethoxy)phenyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[5-bromo-2-(2-methylsulfonylethoxy)phenyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 63056495 |
| Molecular Formula | C14H22BrNO3S |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | N-[[5-bromo-2-(2-methylsulfonylethoxy)phenyl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1cc(Br)ccc1OCCS(C)(=O)=O |
| InChI | InChI=1S/C14H22BrNO3S/c1-11(2)9-16-10-12-8-13(15)4-5-14(12)19-6-7-20(3,17)18/h4-5,8,11,16H,6-7,9-10H2,1-3H3 |
| InChIKey | OXWWYAVPJBGIMY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |