C15H25NO3S — CID 63327030
2-methyl-N-[[5-methyl-2-(2-methylsulfonylethoxy)phenyl]methyl]propan-1-amine (PubChem CID 63327030) has the molecular formula C15H25NO3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 2-methyl-N-[[5-methyl-2-(2-methylsulfonylethoxy)phenyl]methyl]propan-1-amine.
| Compound Name | 2-methyl-N-[[5-methyl-2-(2-methylsulfonylethoxy)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 63327030 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 2-methyl-N-[[5-methyl-2-(2-methylsulfonylethoxy)phenyl]methyl]propan-1-amine |
| SMILES | Cc1ccc(OCCS(C)(=O)=O)c(CNCC(C)C)c1 |
| InChI | InChI=1S/C15H25NO3S/c1-12(2)10-16-11-14-9-13(3)5-6-15(14)19-7-8-20(4,17)18/h5-6,9,12,16H,7-8,10-11H2,1-4H3 |
| InChIKey | LMJDVJLOQANJKR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |