C14H21ClN2O3S — CID 63060589
N-[[2-chloro-6-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methyl]-2-methoxyethanamine (PubChem CID 63060589) has the molecular formula C14H21ClN2O3S and a molecular weight of 332.85 g/mol. Its IUPAC name is N-[[2-chloro-6-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[2-chloro-6-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 63060589 |
| Molecular Formula | C14H21ClN2O3S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | N-[[2-chloro-6-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1c(Cl)cccc1N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H21ClN2O3S/c1-20-8-5-16-11-12-13(15)3-2-4-14(12)17-6-9-21(18,19)10-7-17/h2-4,16H,5-11H2,1H3 |
| InChIKey | FCVBTBHYAWSKKP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|