C15H24BrNO2 — CID 63061654
1-[2-bromo-4-[(tert-butylamino)methyl]phenoxy]-2-methylpropan-2-ol (PubChem CID 63061654) has the molecular formula C15H24BrNO2 and a molecular weight of 330.27 g/mol. Its IUPAC name is 1-[2-bromo-4-[(tert-butylamino)methyl]phenoxy]-2-methylpropan-2-ol.
| Compound Name | 1-[2-bromo-4-[(tert-butylamino)methyl]phenoxy]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 63061654 |
| Molecular Formula | C15H24BrNO2 |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 1-[2-bromo-4-[(tert-butylamino)methyl]phenoxy]-2-methylpropan-2-ol |
| SMILES | CC(C)(O)COc1ccc(CNC(C)(C)C)cc1Br |
| InChI | InChI=1S/C15H24BrNO2/c1-14(2,3)17-9-11-6-7-13(12(16)8-11)19-10-15(4,5)18/h6-8,17-18H,9-10H2,1-5H3 |
| InChIKey | KIIHAGUBCCFNHI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |