C13H13N3O5 — CID 63062455
1-[2-(2-nitrophenyl)ethyl]-6-oxo-4,5-dihydropyridazine-3-carboxylic acid (PubChem CID 63062455) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is 1-[2-(2-nitrophenyl)ethyl]-6-oxo-4,5-dihydropyridazine-3-carboxylic acid.
| Compound Name | 1-[2-(2-nitrophenyl)ethyl]-6-oxo-4,5-dihydropyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 63062455 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 1-[2-(2-nitrophenyl)ethyl]-6-oxo-4,5-dihydropyridazine-3-carboxylic acid |
| SMILES | O=C(O)C1=NN(CCc2ccccc2[N+](=O)[O-])C(=O)CC1 |
| InChI | InChI=1S/C13H13N3O5/c17-12-6-5-10(13(18)19)14-15(12)8-7-9-3-1-2-4-11(9)16(20)21/h1-4H,5-8H2,(H,18,19) |
| InChIKey | TWGFXDZQPYMWIV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|