C12H16FN3O3 — CID 63064124
N-carbamoyl-2-[5-fluoro-2-[1-(methylamino)ethyl]phenoxy]acetamide (PubChem CID 63064124) has the molecular formula C12H16FN3O3 and a molecular weight of 269.28 g/mol. Its IUPAC name is N-carbamoyl-2-[5-fluoro-2-[1-(methylamino)ethyl]phenoxy]acetamide.
| Compound Name | N-carbamoyl-2-[5-fluoro-2-[1-(methylamino)ethyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 63064124 |
| Molecular Formula | C12H16FN3O3 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-carbamoyl-2-[5-fluoro-2-[1-(methylamino)ethyl]phenoxy]acetamide |
| SMILES | CNC(C)c1ccc(F)cc1OCC(=O)NC(N)=O |
| InChI | InChI=1S/C12H16FN3O3/c1-7(15-2)9-4-3-8(13)5-10(9)19-6-11(17)16-12(14)18/h3-5,7,15H,6H2,1-2H3,(H3,14,16,17,18) |
| InChIKey | SEEWYSIJEQUNMB-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |