About 2-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]-(2-methylpropyl)amino]acetic acid
2-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]-(2-methylpropyl)amino]acetic acid (PubChem CID 63066154) has the molecular formula C14H28N2O3
and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]-(2-methylpropyl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]-(2-methylpropyl)amino]acetic acid |
| PubChem CID | 63066154 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 2-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]-(2-methylpropyl)amino]acetic acid |
| SMILES | CC(C)CN(CC(=O)O)C(=O)N(C)C(C)C(C)(C)C |
| InChI | InChI=1S/C14H28N2O3/c1-10(2)8-16(9-12(17)18)13(19)15(7)11(3)14(4,5)6/h10-11H,8-9H2,1-7H3,(H,17,18) |
| InChIKey | BQCQKTPWKVVSKC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]-(2-methylpropyl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]-(2-methylpropyl)amino]acetic acid?
The IUPAC name of 2-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]-(2-methylpropyl)amino]acetic acid (CID 63066154) is 2-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]-(2-methylpropyl)amino]acetic acid.
What is the SMILES notation for 2-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]-(2-methylpropyl)amino]acetic acid?
The canonical SMILES for 2-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]-(2-methylpropyl)amino]acetic acid is CC(C)CN(CC(=O)O)C(=O)N(C)C(C)C(C)(C)C.
What is the InChIKey of 2-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]-(2-methylpropyl)amino]acetic acid?
The InChIKey is BQCQKTPWKVVSKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O3/c1-10(2)8-16(9-12(17)18)13(19)15(7)11(3)14(4,5)6/h10-11H,8-9H2,1-7H3,(H,17,18).
What are the key properties of 2-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]-(2-methylpropyl)amino]acetic acid?
2-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]-(2-methylpropyl)amino]acetic acid has a molecular weight of 272.39 g/mol, XLogP of 2.52, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[3,3-dimethylbutan-2-yl(methyl)carbamoyl]-(2-methylpropyl)amino]acetic acid is sourced from PubChem (CID 63066154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).