C13H25N3O4 — CID 79257345
2-[[(2-amino-2-oxoethyl)-(2-methylpropyl)carbamoyl]-tert-butylamino]acetic acid (PubChem CID 79257345) has the molecular formula C13H25N3O4 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[[(2-amino-2-oxoethyl)-(2-methylpropyl)carbamoyl]-tert-butylamino]acetic acid.
| Compound Name | 2-[[(2-amino-2-oxoethyl)-(2-methylpropyl)carbamoyl]-tert-butylamino]acetic acid |
|---|---|
| PubChem CID | 79257345 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | 2-[[(2-amino-2-oxoethyl)-(2-methylpropyl)carbamoyl]-tert-butylamino]acetic acid |
| SMILES | CC(C)CN(CC(N)=O)C(=O)N(CC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C13H25N3O4/c1-9(2)6-15(7-10(14)17)12(20)16(8-11(18)19)13(3,4)5/h9H,6-8H2,1-5H3,(H2,14,17)(H,18,19) |
| InChIKey | WHEMOORGHUGMLO-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |