C12H15F3N2O2 — CID 63067094
4,4,4-trifluoro-3-[methyl(2-pyridin-4-ylethyl)amino]butanoic acid (PubChem CID 63067094) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-[methyl(2-pyridin-4-ylethyl)amino]butanoic acid.
| Compound Name | 4,4,4-trifluoro-3-[methyl(2-pyridin-4-ylethyl)amino]butanoic acid |
|---|---|
| PubChem CID | 63067094 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 4,4,4-trifluoro-3-[methyl(2-pyridin-4-ylethyl)amino]butanoic acid |
| SMILES | CN(CCc1ccncc1)C(CC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C12H15F3N2O2/c1-17(7-4-9-2-5-16-6-3-9)10(8-11(18)19)12(13,14)15/h2-3,5-6,10H,4,7-8H2,1H3,(H,18,19) |
| InChIKey | RSRCHHFUEHPODL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |