C17H25N3S — CID 63069776
N,2-dimethyl-4-[(2-methylpropylamino)methyl]-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 63069776) has the molecular formula C17H25N3S and a molecular weight of 303.48 g/mol. Its IUPAC name is N,2-dimethyl-4-[(2-methylpropylamino)methyl]-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | N,2-dimethyl-4-[(2-methylpropylamino)methyl]-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 63069776 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.48 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | N,2-dimethyl-4-[(2-methylpropylamino)methyl]-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | Cc1cc(CNCC(C)C)ccc1N(C)Cc1cscn1 |
| InChI | InChI=1S/C17H25N3S/c1-13(2)8-18-9-15-5-6-17(14(3)7-15)20(4)10-16-11-21-12-19-16/h5-7,11-13,18H,8-10H2,1-4H3 |
| InChIKey | RPQHHNZYHACIGR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|