C16H22FN3S — CID 63072263
2-fluoro-N-methyl-4-[(2-methylpropylamino)methyl]-N-(1,3-thiazol-4-ylmethyl)aniline (PubChem CID 63072263) has the molecular formula C16H22FN3S and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-fluoro-N-methyl-4-[(2-methylpropylamino)methyl]-N-(1,3-thiazol-4-ylmethyl)aniline.
| Compound Name | 2-fluoro-N-methyl-4-[(2-methylpropylamino)methyl]-N-(1,3-thiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 63072263 |
| Molecular Formula | C16H22FN3S |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-fluoro-N-methyl-4-[(2-methylpropylamino)methyl]-N-(1,3-thiazol-4-ylmethyl)aniline |
| SMILES | CC(C)CNCc1ccc(N(C)Cc2cscn2)c(F)c1 |
| InChI | InChI=1S/C16H22FN3S/c1-12(2)7-18-8-13-4-5-16(15(17)6-13)20(3)9-14-10-21-11-19-14/h4-6,10-12,18H,7-9H2,1-3H3 |
| InChIKey | IRBRSBXEPGSAPD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|