3-(4-ethoxyphenoxy)-4,4,4-trifluorobutanoic acid

C12H13F3O4 — CID 63073593

IUPAC3-(4-ethoxyphenoxy)-4,4,4-trifluorobutanoic acid
SMILESCCOc1ccc(OC(CC(=O)O)C(F)(F)F)cc1
InChIInChI=1S/C12H13F3O4/c1-2-18-8-3-5-9(6-4-8)19-10(7-11(16)17)12(13,14)15/h3-6,10H,2,7H2,1H3,(H,16,17)
InChIKeyFGOQSICDCXAYCJ-UHFFFAOYSA-N
MW278.23 g/mol
LogP2.87
Rot. Bonds6

About 3-(4-ethoxyphenoxy)-4,4,4-trifluorobutanoic acid

3-(4-ethoxyphenoxy)-4,4,4-trifluorobutanoic acid (PubChem CID 63073593) has the molecular formula C12H13F3O4 and a molecular weight of 278.23 g/mol. Its IUPAC name is 3-(4-ethoxyphenoxy)-4,4,4-trifluorobutanoic acid.

Molecular Properties

Compound Name3-(4-ethoxyphenoxy)-4,4,4-trifluorobutanoic acid
PubChem CID63073593
Molecular FormulaC12H13F3O4
Molecular Weight278.23 g/mol
Exact Mass278.08
IUPAC Name3-(4-ethoxyphenoxy)-4,4,4-trifluorobutanoic acid
SMILESCCOc1ccc(OC(CC(=O)O)C(F)(F)F)cc1
InChIInChI=1S/C12H13F3O4/c1-2-18-8-3-5-9(6-4-8)19-10(7-11(16)17)12(13,14)15/h3-6,10H,2,7H2,1H3,(H,16,17)
InChIKeyFGOQSICDCXAYCJ-UHFFFAOYSA-N
XLogP2.87
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.23
LogP ≤ 52.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(4-ethoxyphenoxy)-4,4,4-trifluorobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-ethoxyphenoxy)-4,4,4-trifluorobutanoic acid?
The IUPAC name of 3-(4-ethoxyphenoxy)-4,4,4-trifluorobutanoic acid (CID 63073593) is 3-(4-ethoxyphenoxy)-4,4,4-trifluorobutanoic acid.
What is the SMILES notation for 3-(4-ethoxyphenoxy)-4,4,4-trifluorobutanoic acid?
The canonical SMILES for 3-(4-ethoxyphenoxy)-4,4,4-trifluorobutanoic acid is CCOc1ccc(OC(CC(=O)O)C(F)(F)F)cc1.
What is the InChIKey of 3-(4-ethoxyphenoxy)-4,4,4-trifluorobutanoic acid?
The InChIKey is FGOQSICDCXAYCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13F3O4/c1-2-18-8-3-5-9(6-4-8)19-10(7-11(16)17)12(13,14)15/h3-6,10H,2,7H2,1H3,(H,16,17).
What are the key properties of 3-(4-ethoxyphenoxy)-4,4,4-trifluorobutanoic acid?
3-(4-ethoxyphenoxy)-4,4,4-trifluorobutanoic acid has a molecular weight of 278.23 g/mol, XLogP of 2.87, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-ethoxyphenoxy)-4,4,4-trifluorobutanoic acid is sourced from PubChem (CID 63073593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).