C18H17NO2 — CID 63073735
3-(3-methylindol-1-yl)-2-phenylpropanoic acid (PubChem CID 63073735) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-(3-methylindol-1-yl)-2-phenylpropanoic acid.
| Compound Name | 3-(3-methylindol-1-yl)-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 63073735 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3-(3-methylindol-1-yl)-2-phenylpropanoic acid |
| SMILES | Cc1cn(CC(C(=O)O)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C18H17NO2/c1-13-11-19(17-10-6-5-9-15(13)17)12-16(18(20)21)14-7-3-2-4-8-14/h2-11,16H,12H2,1H3,(H,20,21) |
| InChIKey | KRUGHMFYFXMEHQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |