C18H15N3O4 — CID 630769
N-[6-(furan-2-carbonyl)-2-(4-methylphenyl)-3-oxopyridazin-4-yl]acetamide (PubChem CID 630769) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is N-[6-(furan-2-carbonyl)-2-(4-methylphenyl)-3-oxopyridazin-4-yl]acetamide.
| Compound Name | N-[6-(furan-2-carbonyl)-2-(4-methylphenyl)-3-oxopyridazin-4-yl]acetamide |
|---|---|
| PubChem CID | 630769 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | N-[6-(furan-2-carbonyl)-2-(4-methylphenyl)-3-oxopyridazin-4-yl]acetamide |
| SMILES | CC(=O)Nc1cc(C(=O)c2ccco2)nn(-c2ccc(C)cc2)c1=O |
| InChI | InChI=1S/C18H15N3O4/c1-11-5-7-13(8-6-11)21-18(24)15(19-12(2)22)10-14(20-21)17(23)16-4-3-9-25-16/h3-10H,1-2H3,(H,19,22) |
| InChIKey | YBTXKTMVGWBPOW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |