C17H18F2O2 — CID 63078112
[4-(2-butan-2-ylphenoxy)-3,5-difluorophenyl]methanol (PubChem CID 63078112) has the molecular formula C17H18F2O2 and a molecular weight of 292.33 g/mol. Its IUPAC name is [4-(2-butan-2-ylphenoxy)-3,5-difluorophenyl]methanol.
| Compound Name | [4-(2-butan-2-ylphenoxy)-3,5-difluorophenyl]methanol |
|---|---|
| PubChem CID | 63078112 |
| Molecular Formula | C17H18F2O2 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | [4-(2-butan-2-ylphenoxy)-3,5-difluorophenyl]methanol |
| SMILES | CCC(C)c1ccccc1Oc1c(F)cc(CO)cc1F |
| InChI | InChI=1S/C17H18F2O2/c1-3-11(2)13-6-4-5-7-16(13)21-17-14(18)8-12(10-20)9-15(17)19/h4-9,11,20H,3,10H2,1-2H3 |
| InChIKey | ZNLLKDKJLRINND-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |