C14H16ClNO2S — CID 80693446
[2-(2-butan-2-ylphenoxy)-4-chloro-1,3-thiazol-5-yl]methanol (PubChem CID 80693446) has the molecular formula C14H16ClNO2S and a molecular weight of 297.81 g/mol. Its IUPAC name is [2-(2-butan-2-ylphenoxy)-4-chloro-1,3-thiazol-5-yl]methanol.
| Compound Name | [2-(2-butan-2-ylphenoxy)-4-chloro-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 80693446 |
| Molecular Formula | C14H16ClNO2S |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | [2-(2-butan-2-ylphenoxy)-4-chloro-1,3-thiazol-5-yl]methanol |
| SMILES | CCC(C)c1ccccc1Oc1nc(Cl)c(CO)s1 |
| InChI | InChI=1S/C14H16ClNO2S/c1-3-9(2)10-6-4-5-7-11(10)18-14-16-13(15)12(8-17)19-14/h4-7,9,17H,3,8H2,1-2H3 |
| InChIKey | TVFLYLUECMGBKM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |