C13H13N3O5 — CID 63084607
1-[5-(3,5-dinitrophenyl)furan-2-yl]propan-2-amine (PubChem CID 63084607) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is 1-[5-(3,5-dinitrophenyl)furan-2-yl]propan-2-amine.
| Compound Name | 1-[5-(3,5-dinitrophenyl)furan-2-yl]propan-2-amine |
|---|---|
| PubChem CID | 63084607 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 1-[5-(3,5-dinitrophenyl)furan-2-yl]propan-2-amine |
| SMILES | CC(N)Cc1ccc(-c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C13H13N3O5/c1-8(14)4-12-2-3-13(21-12)9-5-10(15(17)18)7-11(6-9)16(19)20/h2-3,5-8H,4,14H2,1H3 |
| InChIKey | CRSQCLQLUAWSAL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 125.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|