C13H9ClF2N2O — CID 63086917
3-chloro-4-(3,5-difluorophenoxy)benzenecarboximidamide (PubChem CID 63086917) has the molecular formula C13H9ClF2N2O and a molecular weight of 282.68 g/mol. Its IUPAC name is 3-chloro-4-(3,5-difluorophenoxy)benzenecarboximidamide.
| Compound Name | 3-chloro-4-(3,5-difluorophenoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 63086917 |
| Molecular Formula | C13H9ClF2N2O |
| Molecular Weight | 282.68 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 3-chloro-4-(3,5-difluorophenoxy)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Oc2cc(F)cc(F)c2)c(Cl)c1 |
| InChI | InChI=1S/C13H9ClF2N2O/c14-11-3-7(13(17)18)1-2-12(11)19-10-5-8(15)4-9(16)6-10/h1-6H,(H3,17,18) |
| InChIKey | YAHXQSQIOQKMBN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.68 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|