C16H22N2O2 — CID 63090820
2-[(1-amino-2,3-dihydro-1H-inden-4-yl)oxy]-N-cyclopentylacetamide (PubChem CID 63090820) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-[(1-amino-2,3-dihydro-1H-inden-4-yl)oxy]-N-cyclopentylacetamide.
| Compound Name | 2-[(1-amino-2,3-dihydro-1H-inden-4-yl)oxy]-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 63090820 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 2-[(1-amino-2,3-dihydro-1H-inden-4-yl)oxy]-N-cyclopentylacetamide |
| SMILES | NC1CCc2c(OCC(=O)NC3CCCC3)cccc21 |
| InChI | InChI=1S/C16H22N2O2/c17-14-9-8-13-12(14)6-3-7-15(13)20-10-16(19)18-11-4-1-2-5-11/h3,6-7,11,14H,1-2,4-5,8-10,17H2,(H,18,19) |
| InChIKey | SFXKFIFGOBYEJR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |