About 2-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]-N-(oxan-4-yl)acetamide
2-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]-N-(oxan-4-yl)acetamide (PubChem CID 63091211) has the molecular formula C16H21NO4
and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]-N-(oxan-4-yl)acetamide.
Molecular Properties
| Compound Name | 2-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]-N-(oxan-4-yl)acetamide |
| PubChem CID | 63091211 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]-N-(oxan-4-yl)acetamide |
| SMILES | O=C(COc1cccc2c1CCC2O)NC1CCOCC1 |
| InChI | InChI=1S/C16H21NO4/c18-14-5-4-13-12(14)2-1-3-15(13)21-10-16(19)17-11-6-8-20-9-7-11/h1-3,11,14,18H,4-10H2,(H,17,19) |
| InChIKey | SPSIGMJKTIEMAT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]-N-(oxan-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]-N-(oxan-4-yl)acetamide?
The IUPAC name of 2-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]-N-(oxan-4-yl)acetamide (CID 63091211) is 2-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]-N-(oxan-4-yl)acetamide.
What is the SMILES notation for 2-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]-N-(oxan-4-yl)acetamide?
The canonical SMILES for 2-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]-N-(oxan-4-yl)acetamide is O=C(COc1cccc2c1CCC2O)NC1CCOCC1.
What is the InChIKey of 2-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]-N-(oxan-4-yl)acetamide?
The InChIKey is SPSIGMJKTIEMAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO4/c18-14-5-4-13-12(14)2-1-3-15(13)21-10-16(19)17-11-6-8-20-9-7-11/h1-3,11,14,18H,4-10H2,(H,17,19).
What are the key properties of 2-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]-N-(oxan-4-yl)acetamide?
2-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]-N-(oxan-4-yl)acetamide has a molecular weight of 291.35 g/mol, XLogP of 1.34, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-hydroxy-2,3-dihydro-1H-inden-4-yl)oxy]-N-(oxan-4-yl)acetamide is sourced from PubChem (CID 63091211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).