C17H19N3S — CID 63095112
N-[1-(2-quinolin-6-yl-1,3-thiazol-5-yl)ethyl]propan-1-amine (PubChem CID 63095112) has the molecular formula C17H19N3S and a molecular weight of 297.43 g/mol. Its IUPAC name is N-[1-(2-quinolin-6-yl-1,3-thiazol-5-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(2-quinolin-6-yl-1,3-thiazol-5-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 63095112 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | N-[1-(2-quinolin-6-yl-1,3-thiazol-5-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1cnc(-c2ccc3ncccc3c2)s1 |
| InChI | InChI=1S/C17H19N3S/c1-3-8-18-12(2)16-11-20-17(21-16)14-6-7-15-13(10-14)5-4-9-19-15/h4-7,9-12,18H,3,8H2,1-2H3 |
| InChIKey | ATQMCIQRTJTMCU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |