C14H13NO6 — CID 63097481
2-[2-(2-methyl-1,3-dioxo-4H-isoquinolin-7-yl)-2-oxoethoxy]acetic acid (PubChem CID 63097481) has the molecular formula C14H13NO6 and a molecular weight of 291.26 g/mol. Its IUPAC name is 2-[2-(2-methyl-1,3-dioxo-4H-isoquinolin-7-yl)-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-(2-methyl-1,3-dioxo-4H-isoquinolin-7-yl)-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 63097481 |
| Molecular Formula | C14H13NO6 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-[2-(2-methyl-1,3-dioxo-4H-isoquinolin-7-yl)-2-oxoethoxy]acetic acid |
| SMILES | CN1C(=O)Cc2ccc(C(=O)COCC(=O)O)cc2C1=O |
| InChI | InChI=1S/C14H13NO6/c1-15-12(17)5-8-2-3-9(4-10(8)14(15)20)11(16)6-21-7-13(18)19/h2-4H,5-7H2,1H3,(H,18,19) |
| InChIKey | WRXGJWZGUFSNCX-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|