C14H12BrNO5 — CID 79782415
3-bromo-4-(2-methyl-1,3-dioxo-4H-isoquinolin-7-yl)-4-oxobutanoic acid (PubChem CID 79782415) has the molecular formula C14H12BrNO5 and a molecular weight of 354.16 g/mol. Its IUPAC name is 3-bromo-4-(2-methyl-1,3-dioxo-4H-isoquinolin-7-yl)-4-oxobutanoic acid.
| Compound Name | 3-bromo-4-(2-methyl-1,3-dioxo-4H-isoquinolin-7-yl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 79782415 |
| Molecular Formula | C14H12BrNO5 |
| Molecular Weight | 354.16 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 3-bromo-4-(2-methyl-1,3-dioxo-4H-isoquinolin-7-yl)-4-oxobutanoic acid |
| SMILES | CN1C(=O)Cc2ccc(C(=O)C(Br)CC(=O)O)cc2C1=O |
| InChI | InChI=1S/C14H12BrNO5/c1-16-11(17)5-7-2-3-8(4-9(7)14(16)21)13(20)10(15)6-12(18)19/h2-4,10H,5-6H2,1H3,(H,18,19) |
| InChIKey | SIXIGVCFMURBCQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.16 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|