C15H19NO3 — CID 63099420
N-[1-(furan-2-yl)propan-2-yl]-3,4-dimethoxyaniline (PubChem CID 63099420) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-[1-(furan-2-yl)propan-2-yl]-3,4-dimethoxyaniline.
| Compound Name | N-[1-(furan-2-yl)propan-2-yl]-3,4-dimethoxyaniline |
|---|---|
| PubChem CID | 63099420 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | N-[1-(furan-2-yl)propan-2-yl]-3,4-dimethoxyaniline |
| SMILES | COc1ccc(NC(C)Cc2ccco2)cc1OC |
| InChI | InChI=1S/C15H19NO3/c1-11(9-13-5-4-8-19-13)16-12-6-7-14(17-2)15(10-12)18-3/h4-8,10-11,16H,9H2,1-3H3 |
| InChIKey | IFONRRFRXKKGOL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|