C16H25ClN2O2 — CID 63101220
1-[4-[2-(3-chlorophenoxy)ethyl]piperazin-1-yl]-2-methylpropan-2-ol (PubChem CID 63101220) has the molecular formula C16H25ClN2O2 and a molecular weight of 312.84 g/mol. Its IUPAC name is 1-[4-[2-(3-chlorophenoxy)ethyl]piperazin-1-yl]-2-methylpropan-2-ol.
| Compound Name | 1-[4-[2-(3-chlorophenoxy)ethyl]piperazin-1-yl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 63101220 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-[4-[2-(3-chlorophenoxy)ethyl]piperazin-1-yl]-2-methylpropan-2-ol |
| SMILES | CC(C)(O)CN1CCN(CCOc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C16H25ClN2O2/c1-16(2,20)13-19-8-6-18(7-9-19)10-11-21-15-5-3-4-14(17)12-15/h3-5,12,20H,6-11,13H2,1-2H3 |
| InChIKey | HKYFCALYIPRLPT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |