C17H27ClN4O3S — CID 60500567
1-[4-[2-(3-chlorophenoxy)ethyl]piperazin-1-yl]sulfonyl-4-methylpiperazine (PubChem CID 60500567) has the molecular formula C17H27ClN4O3S and a molecular weight of 402.95 g/mol. Its IUPAC name is 1-[4-[2-(3-chlorophenoxy)ethyl]piperazin-1-yl]sulfonyl-4-methylpiperazine.
| Compound Name | 1-[4-[2-(3-chlorophenoxy)ethyl]piperazin-1-yl]sulfonyl-4-methylpiperazine |
|---|---|
| PubChem CID | 60500567 |
| Molecular Formula | C17H27ClN4O3S |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 1-[4-[2-(3-chlorophenoxy)ethyl]piperazin-1-yl]sulfonyl-4-methylpiperazine |
| SMILES | CN1CCN(S(=O)(=O)N2CCN(CCOc3cccc(Cl)c3)CC2)CC1 |
| InChI | InChI=1S/C17H27ClN4O3S/c1-19-5-9-21(10-6-19)26(23,24)22-11-7-20(8-12-22)13-14-25-17-4-2-3-16(18)15-17/h2-4,15H,5-14H2,1H3 |
| InChIKey | IMHCNEKWEXFAPW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |