C16H23Cl2N3O4S — CID 36931838
4-[4-[2-(2,6-dichlorophenoxy)ethyl]piperazin-1-yl]sulfonylmorpholine (PubChem CID 36931838) has the molecular formula C16H23Cl2N3O4S and a molecular weight of 424.35 g/mol. Its IUPAC name is 4-[4-[2-(2,6-dichlorophenoxy)ethyl]piperazin-1-yl]sulfonylmorpholine.
| Compound Name | 4-[4-[2-(2,6-dichlorophenoxy)ethyl]piperazin-1-yl]sulfonylmorpholine |
|---|---|
| PubChem CID | 36931838 |
| Molecular Formula | C16H23Cl2N3O4S |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 4-[4-[2-(2,6-dichlorophenoxy)ethyl]piperazin-1-yl]sulfonylmorpholine |
| SMILES | O=S(=O)(N1CCOCC1)N1CCN(CCOc2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C16H23Cl2N3O4S/c17-14-2-1-3-15(18)16(14)25-13-8-19-4-6-20(7-5-19)26(22,23)21-9-11-24-12-10-21/h1-3H,4-13H2 |
| InChIKey | UKJFVQPLTKLJOU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |