C18H20Cl2N2O2 — CID 8690234
4-[4-[2-(2,6-dichlorophenoxy)ethyl]piperazin-1-yl]phenol (PubChem CID 8690234) has the molecular formula C18H20Cl2N2O2 and a molecular weight of 367.28 g/mol. Its IUPAC name is 4-[4-[2-(2,6-dichlorophenoxy)ethyl]piperazin-1-yl]phenol.
| Compound Name | 4-[4-[2-(2,6-dichlorophenoxy)ethyl]piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 8690234 |
| Molecular Formula | C18H20Cl2N2O2 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 4-[4-[2-(2,6-dichlorophenoxy)ethyl]piperazin-1-yl]phenol |
| SMILES | Oc1ccc(N2CCN(CCOc3c(Cl)cccc3Cl)CC2)cc1 |
| InChI | InChI=1S/C18H20Cl2N2O2/c19-16-2-1-3-17(20)18(16)24-13-12-21-8-10-22(11-9-21)14-4-6-15(23)7-5-14/h1-7,23H,8-13H2 |
| InChIKey | LPTMPIIZSRWCML-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |