C13H17F2N3O2 — CID 63102211
N-[2-(difluoromethoxy)phenyl]-5-methylpiperazine-2-carboxamide (PubChem CID 63102211) has the molecular formula C13H17F2N3O2 and a molecular weight of 285.29 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-5-methylpiperazine-2-carboxamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-5-methylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 63102211 |
| Molecular Formula | C13H17F2N3O2 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-5-methylpiperazine-2-carboxamide |
| SMILES | CC1CNC(C(=O)Nc2ccccc2OC(F)F)CN1 |
| InChI | InChI=1S/C13H17F2N3O2/c1-8-6-17-10(7-16-8)12(19)18-9-4-2-3-5-11(9)20-13(14)15/h2-5,8,10,13,16-17H,6-7H2,1H3,(H,18,19) |
| InChIKey | VUUYHIVIAYMKDB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |