C16H25N3 — CID 63104680
1-(2-ethylbenzimidazol-1-yl)-N,3,3-trimethylbutan-2-amine (PubChem CID 63104680) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 1-(2-ethylbenzimidazol-1-yl)-N,3,3-trimethylbutan-2-amine.
| Compound Name | 1-(2-ethylbenzimidazol-1-yl)-N,3,3-trimethylbutan-2-amine |
|---|---|
| PubChem CID | 63104680 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 1-(2-ethylbenzimidazol-1-yl)-N,3,3-trimethylbutan-2-amine |
| SMILES | CCc1nc2ccccc2n1CC(NC)C(C)(C)C |
| InChI | InChI=1S/C16H25N3/c1-6-15-18-12-9-7-8-10-13(12)19(15)11-14(17-5)16(2,3)4/h7-10,14,17H,6,11H2,1-5H3 |
| InChIKey | DOWLMUQAIZJWPO-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |