C15H20N2O2 — CID 79629566
methyl 3-(2-ethylbenzimidazol-1-yl)-2,2-dimethylpropanoate (PubChem CID 79629566) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is methyl 3-(2-ethylbenzimidazol-1-yl)-2,2-dimethylpropanoate.
| Compound Name | methyl 3-(2-ethylbenzimidazol-1-yl)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 79629566 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | methyl 3-(2-ethylbenzimidazol-1-yl)-2,2-dimethylpropanoate |
| SMILES | CCc1nc2ccccc2n1CC(C)(C)C(=O)OC |
| InChI | InChI=1S/C15H20N2O2/c1-5-13-16-11-8-6-7-9-12(11)17(13)10-15(2,3)14(18)19-4/h6-9H,5,10H2,1-4H3 |
| InChIKey | JISXAHGOCMEWRK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |