C15H22N4 — CID 65252513
4-(2-ethylbenzimidazol-1-yl)-2,2-dimethylbutanimidamide (PubChem CID 65252513) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is 4-(2-ethylbenzimidazol-1-yl)-2,2-dimethylbutanimidamide.
| Compound Name | 4-(2-ethylbenzimidazol-1-yl)-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 65252513 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 4-(2-ethylbenzimidazol-1-yl)-2,2-dimethylbutanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CCn1c(CC)nc2ccccc21 |
| InChI | InChI=1S/C15H22N4/c1-4-13-18-11-7-5-6-8-12(11)19(13)10-9-15(2,3)14(16)17/h5-8H,4,9-10H2,1-3H3,(H3,16,17) |
| InChIKey | XRUCASYIENRQDM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|