C14H19N3S — CID 65248934
2,2-dimethyl-4-(2-methylbenzimidazol-1-yl)butanethioamide (PubChem CID 65248934) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 2,2-dimethyl-4-(2-methylbenzimidazol-1-yl)butanethioamide.
| Compound Name | 2,2-dimethyl-4-(2-methylbenzimidazol-1-yl)butanethioamide |
|---|---|
| PubChem CID | 65248934 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2,2-dimethyl-4-(2-methylbenzimidazol-1-yl)butanethioamide |
| SMILES | Cc1nc2ccccc2n1CCC(C)(C)C(N)=S |
| InChI | InChI=1S/C14H19N3S/c1-10-16-11-6-4-5-7-12(11)17(10)9-8-14(2,3)13(15)18/h4-7H,8-9H2,1-3H3,(H2,15,18) |
| InChIKey | SQOROYXRBDPQFL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|