C11H12FN5O — CID 63110019
2-amino-4-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzamide (PubChem CID 63110019) has the molecular formula C11H12FN5O and a molecular weight of 249.25 g/mol. Its IUPAC name is 2-amino-4-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzamide.
| Compound Name | 2-amino-4-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 63110019 |
| Molecular Formula | C11H12FN5O |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-amino-4-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]benzamide |
| SMILES | Cn1cnnc1CNC(=O)c1ccc(F)cc1N |
| InChI | InChI=1S/C11H12FN5O/c1-17-6-15-16-10(17)5-14-11(18)8-3-2-7(12)4-9(8)13/h2-4,6H,5,13H2,1H3,(H,14,18) |
| InChIKey | PDBXGMJTADXONV-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|