C10H9ClFN5O — CID 103893192
2-chloro-5-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyridine-3-carboxamide (PubChem CID 103893192) has the molecular formula C10H9ClFN5O and a molecular weight of 269.67 g/mol. Its IUPAC name is 2-chloro-5-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyridine-3-carboxamide.
| Compound Name | 2-chloro-5-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103893192 |
| Molecular Formula | C10H9ClFN5O |
| Molecular Weight | 269.67 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 2-chloro-5-fluoro-N-[(4-methyl-1,2,4-triazol-3-yl)methyl]pyridine-3-carboxamide |
| SMILES | Cn1cnnc1CNC(=O)c1cc(F)cnc1Cl |
| InChI | InChI=1S/C10H9ClFN5O/c1-17-5-15-16-8(17)4-14-10(18)7-2-6(12)3-13-9(7)11/h2-3,5H,4H2,1H3,(H,14,18) |
| InChIKey | LQQKALDDVXAQKJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.67 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|