C13H11BrN2O3S — CID 63113553
2-[(4-bromo-2-methylphenyl)carbamoylamino]thiophene-3-carboxylic acid (PubChem CID 63113553) has the molecular formula C13H11BrN2O3S and a molecular weight of 355.21 g/mol. Its IUPAC name is 2-[(4-bromo-2-methylphenyl)carbamoylamino]thiophene-3-carboxylic acid.
| Compound Name | 2-[(4-bromo-2-methylphenyl)carbamoylamino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63113553 |
| Molecular Formula | C13H11BrN2O3S |
| Molecular Weight | 355.21 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | 2-[(4-bromo-2-methylphenyl)carbamoylamino]thiophene-3-carboxylic acid |
| SMILES | Cc1cc(Br)ccc1NC(=O)Nc1sccc1C(=O)O |
| InChI | InChI=1S/C13H11BrN2O3S/c1-7-6-8(14)2-3-10(7)15-13(19)16-11-9(12(17)18)4-5-20-11/h2-6H,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | CQTGFNJRMCGUSE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.21 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |