C12H7F3N2O3S — CID 63113570
2-[(2,3,4-trifluorophenyl)carbamoylamino]thiophene-3-carboxylic acid (PubChem CID 63113570) has the molecular formula C12H7F3N2O3S and a molecular weight of 316.26 g/mol. Its IUPAC name is 2-[(2,3,4-trifluorophenyl)carbamoylamino]thiophene-3-carboxylic acid.
| Compound Name | 2-[(2,3,4-trifluorophenyl)carbamoylamino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63113570 |
| Molecular Formula | C12H7F3N2O3S |
| Molecular Weight | 316.26 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 2-[(2,3,4-trifluorophenyl)carbamoylamino]thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)Nc1sccc1C(=O)O |
| InChI | InChI=1S/C12H7F3N2O3S/c13-6-1-2-7(9(15)8(6)14)16-12(20)17-10-5(11(18)19)3-4-21-10/h1-4H,(H,18,19)(H2,16,17,20) |
| InChIKey | FEQLVYUFZVAMOI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|