C13H17N3O4S — CID 63113917
2-[[2-(dimethylcarbamoyl)pyrrolidine-1-carbonyl]amino]thiophene-3-carboxylic acid (PubChem CID 63113917) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 2-[[2-(dimethylcarbamoyl)pyrrolidine-1-carbonyl]amino]thiophene-3-carboxylic acid.
| Compound Name | 2-[[2-(dimethylcarbamoyl)pyrrolidine-1-carbonyl]amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63113917 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-[[2-(dimethylcarbamoyl)pyrrolidine-1-carbonyl]amino]thiophene-3-carboxylic acid |
| SMILES | CN(C)C(=O)C1CCCN1C(=O)Nc1sccc1C(=O)O |
| InChI | InChI=1S/C13H17N3O4S/c1-15(2)11(17)9-4-3-6-16(9)13(20)14-10-8(12(18)19)5-7-21-10/h5,7,9H,3-4,6H2,1-2H3,(H,14,20)(H,18,19) |
| InChIKey | SOUUUKFAUBJGSS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |