C12H16N2O4S — CID 112626687
2-[[3-(1-hydroxyethyl)pyrrolidine-1-carbonyl]amino]thiophene-3-carboxylic acid (PubChem CID 112626687) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 2-[[3-(1-hydroxyethyl)pyrrolidine-1-carbonyl]amino]thiophene-3-carboxylic acid.
| Compound Name | 2-[[3-(1-hydroxyethyl)pyrrolidine-1-carbonyl]amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 112626687 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-[[3-(1-hydroxyethyl)pyrrolidine-1-carbonyl]amino]thiophene-3-carboxylic acid |
| SMILES | CC(O)C1CCN(C(=O)Nc2sccc2C(=O)O)C1 |
| InChI | InChI=1S/C12H16N2O4S/c1-7(15)8-2-4-14(6-8)12(18)13-10-9(11(16)17)3-5-19-10/h3,5,7-8,15H,2,4,6H2,1H3,(H,13,18)(H,16,17) |
| InChIKey | VWBMXVPCKKXYMN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |