C14H19N3O3S — CID 63114341
2-[[4-(cyclopropylmethyl)piperazine-1-carbonyl]amino]thiophene-3-carboxylic acid (PubChem CID 63114341) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-[[4-(cyclopropylmethyl)piperazine-1-carbonyl]amino]thiophene-3-carboxylic acid.
| Compound Name | 2-[[4-(cyclopropylmethyl)piperazine-1-carbonyl]amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63114341 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-[[4-(cyclopropylmethyl)piperazine-1-carbonyl]amino]thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1ccsc1NC(=O)N1CCN(CC2CC2)CC1 |
| InChI | InChI=1S/C14H19N3O3S/c18-13(19)11-3-8-21-12(11)15-14(20)17-6-4-16(5-7-17)9-10-1-2-10/h3,8,10H,1-2,4-7,9H2,(H,15,20)(H,18,19) |
| InChIKey | KUEUCZFNRROKBS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |