C12H11F3N2O3S — CID 114490360
2-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]thiophene-3-carboxylic acid (PubChem CID 114490360) has the molecular formula C12H11F3N2O3S and a molecular weight of 320.29 g/mol. Its IUPAC name is 2-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]thiophene-3-carboxylic acid.
| Compound Name | 2-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 114490360 |
| Molecular Formula | C12H11F3N2O3S |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 2-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridine-1-carbonyl]amino]thiophene-3-carboxylic acid |
| SMILES | O=C(O)c1ccsc1NC(=O)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H11F3N2O3S/c13-12(14,15)7-1-4-17(5-2-7)11(20)16-9-8(10(18)19)3-6-21-9/h1,3,6H,2,4-5H2,(H,16,20)(H,18,19) |
| InChIKey | LEZYJNSDSANZAB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|