C13H21NS2 — CID 63115022
1-cyclopentylsulfanyl-1-(3-methylthiophen-2-yl)propan-2-amine (PubChem CID 63115022) has the molecular formula C13H21NS2 and a molecular weight of 255.45 g/mol. Its IUPAC name is 1-cyclopentylsulfanyl-1-(3-methylthiophen-2-yl)propan-2-amine.
| Compound Name | 1-cyclopentylsulfanyl-1-(3-methylthiophen-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 63115022 |
| Molecular Formula | C13H21NS2 |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 1-cyclopentylsulfanyl-1-(3-methylthiophen-2-yl)propan-2-amine |
| SMILES | Cc1ccsc1C(SC1CCCC1)C(C)N |
| InChI | InChI=1S/C13H21NS2/c1-9-7-8-15-12(9)13(10(2)14)16-11-5-3-4-6-11/h7-8,10-11,13H,3-6,14H2,1-2H3 |
| InChIKey | OQVLCAHKFFRDKR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |