C14H22N2O3 — CID 63118452
3-[2-amino-N-(5-hydroxypentyl)anilino]propanoic acid (PubChem CID 63118452) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-[2-amino-N-(5-hydroxypentyl)anilino]propanoic acid.
| Compound Name | 3-[2-amino-N-(5-hydroxypentyl)anilino]propanoic acid |
|---|---|
| PubChem CID | 63118452 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 3-[2-amino-N-(5-hydroxypentyl)anilino]propanoic acid |
| SMILES | Nc1ccccc1N(CCCCCO)CCC(=O)O |
| InChI | InChI=1S/C14H22N2O3/c15-12-6-2-3-7-13(12)16(10-8-14(18)19)9-4-1-5-11-17/h2-3,6-7,17H,1,4-5,8-11,15H2,(H,18,19) |
| InChIKey | NDIYSOWPVUVMAC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|