C34H26O4P2 — CID 631205
1,8-bis(diphenylphosphoryloxy)naphthalene (PubChem CID 631205) has the molecular formula C34H26O4P2 and a molecular weight of 560.53 g/mol. Its IUPAC name is 1,8-bis(diphenylphosphoryloxy)naphthalene.
| Compound Name | 1,8-bis(diphenylphosphoryloxy)naphthalene |
|---|---|
| PubChem CID | 631205 |
| Molecular Formula | C34H26O4P2 |
| Molecular Weight | 560.53 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | 1,8-bis(diphenylphosphoryloxy)naphthalene |
| SMILES | O=P(Oc1cccc2cccc(OP(=O)(c3ccccc3)c3ccccc3)c12)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H26O4P2/c35-39(28-17-5-1-6-18-28,29-19-7-2-8-20-29)37-32-25-13-15-27-16-14-26-33(34(27)32)38-40(36,30-21-9-3-10-22-30)31-23-11-4-12-24-31/h1-26H |
| InChIKey | JSLILUGLNSRVOR-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.53 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|