C15H28N4O2 — CID 63128392
2-[4-(4-ethylpiperidine-4-carbonyl)piperazin-1-yl]-N-methylacetamide (PubChem CID 63128392) has the molecular formula C15H28N4O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 2-[4-(4-ethylpiperidine-4-carbonyl)piperazin-1-yl]-N-methylacetamide.
| Compound Name | 2-[4-(4-ethylpiperidine-4-carbonyl)piperazin-1-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 63128392 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 2-[4-(4-ethylpiperidine-4-carbonyl)piperazin-1-yl]-N-methylacetamide |
| SMILES | CCC1(C(=O)N2CCN(CC(=O)NC)CC2)CCNCC1 |
| InChI | InChI=1S/C15H28N4O2/c1-3-15(4-6-17-7-5-15)14(21)19-10-8-18(9-11-19)12-13(20)16-2/h17H,3-12H2,1-2H3,(H,16,20) |
| InChIKey | FLTQSOOMFQXZKE-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |