C18H16O7 — CID 631298
methyl 3,4,8-trimethoxy-6-oxobenzo[c]chromene-2-carboxylate (PubChem CID 631298) has the molecular formula C18H16O7 and a molecular weight of 344.32 g/mol. Its IUPAC name is methyl 3,4,8-trimethoxy-6-oxobenzo[c]chromene-2-carboxylate.
| Compound Name | methyl 3,4,8-trimethoxy-6-oxobenzo[c]chromene-2-carboxylate |
|---|---|
| PubChem CID | 631298 |
| Molecular Formula | C18H16O7 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | methyl 3,4,8-trimethoxy-6-oxobenzo[c]chromene-2-carboxylate |
| SMILES | COC(=O)c1cc2c(oc(=O)c3cc(OC)ccc32)c(OC)c1OC |
| InChI | InChI=1S/C18H16O7/c1-21-9-5-6-10-11-8-13(17(19)24-4)14(22-2)16(23-3)15(11)25-18(20)12(10)7-9/h5-8H,1-4H3 |
| InChIKey | RYBQWBNIPIBXSC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|